C19H20Cl2O3 — CID 150368917
2,4-bis[5-(chloromethyl)-2-hydroxyphenyl]pentan-3-one (PubChem CID 150368917) has the molecular formula C19H20Cl2O3 and a molecular weight of 367.27 g/mol. Its IUPAC name is 2,4-bis[5-(chloromethyl)-2-hydroxyphenyl]pentan-3-one.
| Compound Name | 2,4-bis[5-(chloromethyl)-2-hydroxyphenyl]pentan-3-one |
|---|---|
| PubChem CID | 150368917 |
| Molecular Formula | C19H20Cl2O3 |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 2,4-bis[5-(chloromethyl)-2-hydroxyphenyl]pentan-3-one |
| SMILES | CC(C(=O)C(C)c1cc(CCl)ccc1O)c1cc(CCl)ccc1O |
| InChI | InChI=1S/C19H20Cl2O3/c1-11(15-7-13(9-20)3-5-17(15)22)19(24)12(2)16-8-14(10-21)4-6-18(16)23/h3-8,11-12,22-23H,9-10H2,1-2H3 |
| InChIKey | GXHPRTGUZZSIOM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|