C15H17NO5 — CID 15037822
tert-butyl 4-benzyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate (PubChem CID 15037822) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is tert-butyl 4-benzyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl 4-benzyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 15037822 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | tert-butyl 4-benzyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)OC(=O)C1Cc1ccccc1 |
| InChI | InChI=1S/C15H17NO5/c1-15(2,3)21-14(19)16-11(12(17)20-13(16)18)9-10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3 |
| InChIKey | MFGBEMRROYABSH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|