C10H9ClN2O2 — CID 150378394
4-chloro-6-methoxy-1-methyl-1,7-naphthyridin-2-one (PubChem CID 150378394) has the molecular formula C10H9ClN2O2 and a molecular weight of 224.65 g/mol. Its IUPAC name is 4-chloro-6-methoxy-1-methyl-1,7-naphthyridin-2-one.
| Compound Name | 4-chloro-6-methoxy-1-methyl-1,7-naphthyridin-2-one |
|---|---|
| PubChem CID | 150378394 |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 4-chloro-6-methoxy-1-methyl-1,7-naphthyridin-2-one |
| SMILES | COc1cc2c(Cl)cc(=O)n(C)c2cn1 |
| InChI | InChI=1S/C10H9ClN2O2/c1-13-8-5-12-9(15-2)3-6(8)7(11)4-10(13)14/h3-5H,1-2H3 |
| InChIKey | GZEULIQTPPZHMS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |