C24H46O2Si2 — CID 15038027
tert-butyl-[(2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-but-1-ynylhept-4-ynoxy]-dimethylsilane (PubChem CID 15038027) has the molecular formula C24H46O2Si2 and a molecular weight of 422.80 g/mol. Its IUPAC name is tert-butyl-[(2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-but-1-ynylhept-4-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-but-1-ynylhept-4-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 15038027 |
| Molecular Formula | C24H46O2Si2 |
| Molecular Weight | 422.80 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | tert-butyl-[(2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-but-1-ynylhept-4-ynoxy]-dimethylsilane |
| SMILES | CCC#C[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](C#CCC)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H46O2Si2/c1-13-15-17-21(19-25-27(9,10)23(3,4)5)22(18-16-14-2)20-26-28(11,12)24(6,7)8/h21-22H,13-14,19-20H2,1-12H3/t21-,22+ |
| InChIKey | XSMYCAOPLGBIMJ-SZPZYZBQSA-N |
| XLogP | 7.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.80 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|