C15H32OSi2 — CID 134963608
tert-butyl-dimethyl-[(2R)-2-methyl-5-trimethylsilylpent-4-ynoxy]silane (PubChem CID 134963608) has the molecular formula C15H32OSi2 and a molecular weight of 284.59 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2R)-2-methyl-5-trimethylsilylpent-4-ynoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(2R)-2-methyl-5-trimethylsilylpent-4-ynoxy]silane |
|---|---|
| PubChem CID | 134963608 |
| Molecular Formula | C15H32OSi2 |
| Molecular Weight | 284.59 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | tert-butyl-dimethyl-[(2R)-2-methyl-5-trimethylsilylpent-4-ynoxy]silane |
| SMILES | C[C@H](CC#C[Si](C)(C)C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H32OSi2/c1-14(11-10-12-17(5,6)7)13-16-18(8,9)15(2,3)4/h14H,11,13H2,1-9H3/t14-/m1/s1 |
| InChIKey | VIFVOCBBNUUBKW-CQSZACIVSA-N |
| XLogP | 4.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.59 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|