C14H30OSi2 — CID 15121704
2,3-dimethylbutan-2-yl-dimethyl-(3-trimethylsilylprop-2-ynoxy)silane (PubChem CID 15121704) has the molecular formula C14H30OSi2 and a molecular weight of 270.56 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-yl-dimethyl-(3-trimethylsilylprop-2-ynoxy)silane.
| Compound Name | 2,3-dimethylbutan-2-yl-dimethyl-(3-trimethylsilylprop-2-ynoxy)silane |
|---|---|
| PubChem CID | 15121704 |
| Molecular Formula | C14H30OSi2 |
| Molecular Weight | 270.56 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 2,3-dimethylbutan-2-yl-dimethyl-(3-trimethylsilylprop-2-ynoxy)silane |
| SMILES | CC(C)C(C)(C)[Si](C)(C)OCC#C[Si](C)(C)C |
| InChI | InChI=1S/C14H30OSi2/c1-13(2)14(3,4)17(8,9)15-11-10-12-16(5,6)7/h13H,11H2,1-9H3 |
| InChIKey | NITBUVFPPTWQKD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|