C20H20ClFN4O3 — CID 150383223
1-[1-(6-chloro-2-pyridinyl)cyclopropyl]-3-[(3S,4R)-4-(2-fluoro-4-methoxyphenyl)-2-oxopyrrolidin-3-yl]urea (PubChem CID 150383223) has the molecular formula C20H20ClFN4O3 and a molecular weight of 418.86 g/mol. Its IUPAC name is 1-[1-(6-chloro-2-pyridinyl)cyclopropyl]-3-[(3S,4R)-4-(2-fluoro-4-methoxyphenyl)-2-oxopyrrolidin-3-yl]urea.
| Compound Name | 1-[1-(6-chloro-2-pyridinyl)cyclopropyl]-3-[(3S,4R)-4-(2-fluoro-4-methoxyphenyl)-2-oxopyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 150383223 |
| Molecular Formula | C20H20ClFN4O3 |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 1-[1-(6-chloro-2-pyridinyl)cyclopropyl]-3-[(3S,4R)-4-(2-fluoro-4-methoxyphenyl)-2-oxopyrrolidin-3-yl]urea |
| SMILES | COc1ccc([C@@H]2CNC(=O)[C@H]2NC(=O)NC2(c3cccc(Cl)n3)CC2)c(F)c1 |
| InChI | InChI=1S/C20H20ClFN4O3/c1-29-11-5-6-12(14(22)9-11)13-10-23-18(27)17(13)25-19(28)26-20(7-8-20)15-3-2-4-16(21)24-15/h2-6,9,13,17H,7-8,10H2,1H3,(H,23,27)(H2,25,26,28)/t13-,17-/m0/s1 |
| InChIKey | HADZSZKVMZZIBQ-GUYCJALGSA-N |
| XLogP | 2.45 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|