C21H21ClF2N4O3 — CID 142493736
1-[1-(6-chloro-4-methyl-2-pyridinyl)cyclopropyl]-3-[(3S,4R)-4-(2,6-difluoro-4-methoxyphenyl)-2-oxopyrrolidin-3-yl]urea (PubChem CID 142493736) has the molecular formula C21H21ClF2N4O3 and a molecular weight of 450.87 g/mol. Its IUPAC name is 1-[1-(6-chloro-4-methyl-2-pyridinyl)cyclopropyl]-3-[(3S,4R)-4-(2,6-difluoro-4-methoxyphenyl)-2-oxopyrrolidin-3-yl]urea.
| Compound Name | 1-[1-(6-chloro-4-methyl-2-pyridinyl)cyclopropyl]-3-[(3S,4R)-4-(2,6-difluoro-4-methoxyphenyl)-2-oxopyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 142493736 |
| Molecular Formula | C21H21ClF2N4O3 |
| Molecular Weight | 450.87 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 1-[1-(6-chloro-4-methyl-2-pyridinyl)cyclopropyl]-3-[(3S,4R)-4-(2,6-difluoro-4-methoxyphenyl)-2-oxopyrrolidin-3-yl]urea |
| SMILES | COc1cc(F)c([C@@H]2CNC(=O)[C@H]2NC(=O)NC2(c3cc(C)cc(Cl)n3)CC2)c(F)c1 |
| InChI | InChI=1S/C21H21ClF2N4O3/c1-10-5-15(26-16(22)6-10)21(3-4-21)28-20(30)27-18-12(9-25-19(18)29)17-13(23)7-11(31-2)8-14(17)24/h5-8,12,18H,3-4,9H2,1-2H3,(H,25,29)(H2,27,28,30)/t12-,18-/m0/s1 |
| InChIKey | TYBWQDSNIWZDJX-SGTLLEGYSA-N |
| XLogP | 2.90 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.87 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|