C14H13F3N6O — CID 150384872
5-[[4-(3-aminopropoxy)-5-(trifluoromethyl)pyrimidin-2-yl]amino]pyridine-2-carbonitrile (PubChem CID 150384872) has the molecular formula C14H13F3N6O and a molecular weight of 338.29 g/mol. Its IUPAC name is 5-[[4-(3-aminopropoxy)-5-(trifluoromethyl)pyrimidin-2-yl]amino]pyridine-2-carbonitrile.
| Compound Name | 5-[[4-(3-aminopropoxy)-5-(trifluoromethyl)pyrimidin-2-yl]amino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 150384872 |
| Molecular Formula | C14H13F3N6O |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 5-[[4-(3-aminopropoxy)-5-(trifluoromethyl)pyrimidin-2-yl]amino]pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(Nc2ncc(C(F)(F)F)c(OCCCN)n2)cn1 |
| InChI | InChI=1S/C14H13F3N6O/c15-14(16,17)11-8-21-13(23-12(11)24-5-1-4-18)22-10-3-2-9(6-19)20-7-10/h2-3,7-8H,1,4-5,18H2,(H,21,22,23) |
| InChIKey | HAMJSFOTNINPFN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|