C58H56N4 — CID 150389764
4-[2-[4-[1-[4-[3-(4-aminophenyl)-1H-indol-2-yl]phenyl]-4-[(4-pentylphenyl)methyl]cyclohexyl]phenyl]-1H-indol-3-yl]aniline (PubChem CID 150389764) has the molecular formula C58H56N4 and a molecular weight of 809.11 g/mol. Its IUPAC name is 4-[2-[4-[1-[4-[3-(4-aminophenyl)-1H-indol-2-yl]phenyl]-4-[(4-pentylphenyl)methyl]cyclohexyl]phenyl]-1H-indol-3-yl]aniline.
| Compound Name | 4-[2-[4-[1-[4-[3-(4-aminophenyl)-1H-indol-2-yl]phenyl]-4-[(4-pentylphenyl)methyl]cyclohexyl]phenyl]-1H-indol-3-yl]aniline |
|---|---|
| PubChem CID | 150389764 |
| Molecular Formula | C58H56N4 |
| Molecular Weight | 809.11 g/mol |
| Exact Mass | 808.45 |
| IUPAC Name | 4-[2-[4-[1-[4-[3-(4-aminophenyl)-1H-indol-2-yl]phenyl]-4-[(4-pentylphenyl)methyl]cyclohexyl]phenyl]-1H-indol-3-yl]aniline |
| SMILES | CCCCCc1ccc(CC2CCC(c3ccc(-c4[nH]c5ccccc5c4-c4ccc(N)cc4)cc3)(c3ccc(-c4[nH]c5ccccc5c4-c4ccc(N)cc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C58H56N4/c1-2-3-4-9-39-14-16-40(17-15-39)38-41-34-36-58(37-35-41,46-26-18-44(19-27-46)56-54(42-22-30-48(59)31-23-42)50-10-5-7-12-52(50)61-56)47-28-20-45(21-29-47)57-55(43-24-32-49(60)33-25-43)51-11-6-8-13-53(51)62-57/h5-8,10-33,41,61-62H,2-4,9,34-38,59-60H2,1H3 |
| InChIKey | HBLMTWCDAHQKCS-UHFFFAOYSA-N |
| XLogP | 14.93 |
| TPSA | 83.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.11 |
| LogP ≤ 5 | 14.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|