C21H45NO2 — CID 150398949
4-(1,1-diethoxyethyl)-N-ethyl-2-methyldodecan-4-amine (PubChem CID 150398949) has the molecular formula C21H45NO2 and a molecular weight of 343.60 g/mol. Its IUPAC name is 4-(1,1-diethoxyethyl)-N-ethyl-2-methyldodecan-4-amine.
| Compound Name | 4-(1,1-diethoxyethyl)-N-ethyl-2-methyldodecan-4-amine |
|---|---|
| PubChem CID | 150398949 |
| Molecular Formula | C21H45NO2 |
| Molecular Weight | 343.60 g/mol |
| Exact Mass | 343.35 |
| IUPAC Name | 4-(1,1-diethoxyethyl)-N-ethyl-2-methyldodecan-4-amine |
| SMILES | CCCCCCCCC(CC(C)C)(NCC)C(C)(OCC)OCC |
| InChI | InChI=1S/C21H45NO2/c1-8-12-13-14-15-16-17-21(22-9-2,18-19(5)6)20(7,23-10-3)24-11-4/h19,22H,8-18H2,1-7H3 |
| InChIKey | HDIOMUQLVIBALX-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.60 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|