C18H24F2N4O2 — CID 150418445
(3S)-3-[[amino-[5-cyclopropyl-4-(2,2-difluoroethoxy)-2-pyridinyl]methylidene]amino]-3-cyclopropylbutanamide (PubChem CID 150418445) has the molecular formula C18H24F2N4O2 and a molecular weight of 366.41 g/mol. Its IUPAC name is (3S)-3-[[amino-[5-cyclopropyl-4-(2,2-difluoroethoxy)-2-pyridinyl]methylidene]amino]-3-cyclopropylbutanamide.
| Compound Name | (3S)-3-[[amino-[5-cyclopropyl-4-(2,2-difluoroethoxy)-2-pyridinyl]methylidene]amino]-3-cyclopropylbutanamide |
|---|---|
| PubChem CID | 150418445 |
| Molecular Formula | C18H24F2N4O2 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (3S)-3-[[amino-[5-cyclopropyl-4-(2,2-difluoroethoxy)-2-pyridinyl]methylidene]amino]-3-cyclopropylbutanamide |
| SMILES | C[C@@](CC(N)=O)(/N=C(\N)c1cc(OCC(F)F)c(C2CC2)cn1)C1CC1 |
| InChI | InChI=1S/C18H24F2N4O2/c1-18(7-16(21)25,11-4-5-11)24-17(22)13-6-14(26-9-15(19)20)12(8-23-13)10-2-3-10/h6,8,10-11,15H,2-5,7,9H2,1H3,(H2,21,25)(H2,22,24)/t18-/m0/s1 |
| InChIKey | HHGRLHFSCKETMS-SFHVURJKSA-N |
| XLogP | 2.35 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|