C11H14F3N3OS — CID 150430952
(Z)-N-ethoxy-1-[3-methyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)imidazol-4-yl]methanimine (PubChem CID 150430952) has the molecular formula C11H14F3N3OS and a molecular weight of 293.31 g/mol. Its IUPAC name is (Z)-N-ethoxy-1-[3-methyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)imidazol-4-yl]methanimine.
| Compound Name | (Z)-N-ethoxy-1-[3-methyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)imidazol-4-yl]methanimine |
|---|---|
| PubChem CID | 150430952 |
| Molecular Formula | C11H14F3N3OS |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | (Z)-N-ethoxy-1-[3-methyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)imidazol-4-yl]methanimine |
| SMILES | CCO/N=C\c1cnc(SCCC(F)=C(F)F)n1C |
| InChI | InChI=1S/C11H14F3N3OS/c1-3-18-16-7-8-6-15-11(17(8)2)19-5-4-9(12)10(13)14/h6-7H,3-5H2,1-2H3/b16-7- |
| InChIKey | HJTNFOJVPOZQSF-APSNUPSMSA-N |
| XLogP | 3.35 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|