C12H26O3Si — CID 150434747
(2R,3S)-2-methyl-3-triethylsilyloxypentanoic acid (PubChem CID 150434747) has the molecular formula C12H26O3Si and a molecular weight of 246.42 g/mol. Its IUPAC name is (2R,3S)-2-methyl-3-triethylsilyloxypentanoic acid.
| Compound Name | (2R,3S)-2-methyl-3-triethylsilyloxypentanoic acid |
|---|---|
| PubChem CID | 150434747 |
| Molecular Formula | C12H26O3Si |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | (2R,3S)-2-methyl-3-triethylsilyloxypentanoic acid |
| SMILES | CC[C@H](O[Si](CC)(CC)CC)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C12H26O3Si/c1-6-11(10(5)12(13)14)15-16(7-2,8-3)9-4/h10-11H,6-9H2,1-5H3,(H,13,14)/t10-,11+/m1/s1 |
| InChIKey | HKNFOADXJMWKPF-MNOVXSKESA-N |
| XLogP | 3.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|