C13H25F3O3Si — CID 172804838
3-[tert-butyl(dimethyl)silyl]oxy-5,5,5-trifluoro-4,4-dimethylpentanoic acid (PubChem CID 172804838) has the molecular formula C13H25F3O3Si and a molecular weight of 314.42 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-5,5,5-trifluoro-4,4-dimethylpentanoic acid.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-5,5,5-trifluoro-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 172804838 |
| Molecular Formula | C13H25F3O3Si |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-5,5,5-trifluoro-4,4-dimethylpentanoic acid |
| SMILES | CC(C)(C(CC(=O)O)O[Si](C)(C)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C13H25F3O3Si/c1-11(2,3)20(6,7)19-9(8-10(17)18)12(4,5)13(14,15)16/h9H,8H2,1-7H3,(H,17,18) |
| InChIKey | RJDFLVABMRVBQL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|