C30H30BF3N2O2 — CID 150437447
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1-(2,2,2-triphenylethyl)pyrazole (PubChem CID 150437447) has the molecular formula C30H30BF3N2O2 and a molecular weight of 518.39 g/mol. Its IUPAC name is 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1-(2,2,2-triphenylethyl)pyrazole.
| Compound Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1-(2,2,2-triphenylethyl)pyrazole |
|---|---|
| PubChem CID | 150437447 |
| Molecular Formula | C30H30BF3N2O2 |
| Molecular Weight | 518.39 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1-(2,2,2-triphenylethyl)pyrazole |
| SMILES | CC1(C)OB(c2cn(CC(c3ccccc3)(c3ccccc3)c3ccccc3)nc2C(F)(F)F)OC1(C)C |
| InChI | InChI=1S/C30H30BF3N2O2/c1-27(2)28(3,4)38-31(37-27)25-20-36(35-26(25)30(32,33)34)21-29(22-14-8-5-9-15-22,23-16-10-6-11-17-23)24-18-12-7-13-19-24/h5-20H,21H2,1-4H3 |
| InChIKey | HLBHBWGTHCJNOA-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.39 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|