C18H22BF3N2O2 — CID 134961553
1,3-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-[4-(trifluoromethyl)phenyl]pyrazole (PubChem CID 134961553) has the molecular formula C18H22BF3N2O2 and a molecular weight of 366.19 g/mol. Its IUPAC name is 1,3-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-[4-(trifluoromethyl)phenyl]pyrazole.
| Compound Name | 1,3-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-[4-(trifluoromethyl)phenyl]pyrazole |
|---|---|
| PubChem CID | 134961553 |
| Molecular Formula | C18H22BF3N2O2 |
| Molecular Weight | 366.19 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1,3-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-[4-(trifluoromethyl)phenyl]pyrazole |
| SMILES | Cc1nn(C)c(-c2ccc(C(F)(F)F)cc2)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H22BF3N2O2/c1-11-14(19-25-16(2,3)17(4,5)26-19)15(24(6)23-11)12-7-9-13(10-8-12)18(20,21)22/h7-10H,1-6H3 |
| InChIKey | MVWPUMGWJLWKNX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.19 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|