C22H20N4O7 — CID 150442180
(4-nitrophenyl) N-[[2-[(3S)-2,7-dioxoazepan-3-yl]-1-oxo-3H-isoindol-4-yl]methyl]carbamate (PubChem CID 150442180) has the molecular formula C22H20N4O7 and a molecular weight of 452.42 g/mol. Its IUPAC name is (4-nitrophenyl) N-[[2-[(3S)-2,7-dioxoazepan-3-yl]-1-oxo-3H-isoindol-4-yl]methyl]carbamate.
| Compound Name | (4-nitrophenyl) N-[[2-[(3S)-2,7-dioxoazepan-3-yl]-1-oxo-3H-isoindol-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 150442180 |
| Molecular Formula | C22H20N4O7 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | (4-nitrophenyl) N-[[2-[(3S)-2,7-dioxoazepan-3-yl]-1-oxo-3H-isoindol-4-yl]methyl]carbamate |
| SMILES | O=C1CCC[C@H](N2Cc3c(CNC(=O)Oc4ccc([N+](=O)[O-])cc4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H20N4O7/c27-19-6-2-5-18(20(28)24-19)25-12-17-13(3-1-4-16(17)21(25)29)11-23-22(30)33-15-9-7-14(8-10-15)26(31)32/h1,3-4,7-10,18H,2,5-6,11-12H2,(H,23,30)(H,24,27,28)/t18-/m0/s1 |
| InChIKey | HLZULZKMDXMPAL-SFHVURJKSA-N |
| XLogP | 2.03 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|