C47H41NO2 — CID 150442471
[4-(2-ethyl-5-propan-2-ylphenyl)-2-(4-methylphenyl)phenyl] 4-(N-naphthalen-1-ylanilino)benzoate (PubChem CID 150442471) has the molecular formula C47H41NO2 and a molecular weight of 651.85 g/mol. Its IUPAC name is [4-(2-ethyl-5-propan-2-ylphenyl)-2-(4-methylphenyl)phenyl] 4-(N-naphthalen-1-ylanilino)benzoate.
| Compound Name | [4-(2-ethyl-5-propan-2-ylphenyl)-2-(4-methylphenyl)phenyl] 4-(N-naphthalen-1-ylanilino)benzoate |
|---|---|
| PubChem CID | 150442471 |
| Molecular Formula | C47H41NO2 |
| Molecular Weight | 651.85 g/mol |
| Exact Mass | 651.31 |
| IUPAC Name | [4-(2-ethyl-5-propan-2-ylphenyl)-2-(4-methylphenyl)phenyl] 4-(N-naphthalen-1-ylanilino)benzoate |
| SMILES | CCc1ccc(C(C)C)cc1-c1ccc(OC(=O)c2ccc(N(c3ccccc3)c3cccc4ccccc34)cc2)c(-c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C47H41NO2/c1-5-34-22-23-38(32(2)3)30-43(34)39-26-29-46(44(31-39)36-20-18-33(4)19-21-36)50-47(49)37-24-27-41(28-25-37)48(40-14-7-6-8-15-40)45-17-11-13-35-12-9-10-16-42(35)45/h6-32H,5H2,1-4H3 |
| InChIKey | HMBIIVIKLRACAC-UHFFFAOYSA-N |
| XLogP | 12.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.85 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|