C36H33NO2 — CID 151725213
[4-(2-ethyl-5-propan-2-ylphenyl)phenyl] 4-(N-phenylanilino)benzoate (PubChem CID 151725213) has the molecular formula C36H33NO2 and a molecular weight of 511.67 g/mol. Its IUPAC name is [4-(2-ethyl-5-propan-2-ylphenyl)phenyl] 4-(N-phenylanilino)benzoate.
| Compound Name | [4-(2-ethyl-5-propan-2-ylphenyl)phenyl] 4-(N-phenylanilino)benzoate |
|---|---|
| PubChem CID | 151725213 |
| Molecular Formula | C36H33NO2 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | [4-(2-ethyl-5-propan-2-ylphenyl)phenyl] 4-(N-phenylanilino)benzoate |
| SMILES | CCc1ccc(C(C)C)cc1-c1ccc(OC(=O)c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C36H33NO2/c1-4-27-15-16-30(26(2)3)25-35(27)28-19-23-34(24-20-28)39-36(38)29-17-21-33(22-18-29)37(31-11-7-5-8-12-31)32-13-9-6-10-14-32/h5-26H,4H2,1-3H3 |
| InChIKey | RJKWEKLGYJRNEH-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|