C52H34N2O6 — CID 132596705
[9,10-dioxo-6-[4-(N-phenylanilino)benzoyl]oxyanthracen-2-yl] 4-(N-phenylanilino)benzoate (PubChem CID 132596705) has the molecular formula C52H34N2O6 and a molecular weight of 782.85 g/mol. Its IUPAC name is [9,10-dioxo-6-[4-(N-phenylanilino)benzoyl]oxyanthracen-2-yl] 4-(N-phenylanilino)benzoate.
| Compound Name | [9,10-dioxo-6-[4-(N-phenylanilino)benzoyl]oxyanthracen-2-yl] 4-(N-phenylanilino)benzoate |
|---|---|
| PubChem CID | 132596705 |
| Molecular Formula | C52H34N2O6 |
| Molecular Weight | 782.85 g/mol |
| Exact Mass | 782.24 |
| IUPAC Name | [9,10-dioxo-6-[4-(N-phenylanilino)benzoyl]oxyanthracen-2-yl] 4-(N-phenylanilino)benzoate |
| SMILES | O=C(Oc1ccc2c(c1)C(=O)c1ccc(OC(=O)c3ccc(N(c4ccccc4)c4ccccc4)cc3)cc1C2=O)c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C52H34N2O6/c55-49-46-32-30-44(60-52(58)36-23-27-42(28-24-36)54(39-17-9-3-10-18-39)40-19-11-4-12-20-40)34-48(46)50(56)45-31-29-43(33-47(45)49)59-51(57)35-21-25-41(26-22-35)53(37-13-5-1-6-14-37)38-15-7-2-8-16-38/h1-34H |
| InChIKey | RXIGZIWGTMZLNI-UHFFFAOYSA-N |
| XLogP | 11.84 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.85 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|