C90H65N3O6 — CID 139957847
[4-[1,1-bis[4-[4-(N-naphthalen-2-ylanilino)benzoyl]oxyphenyl]propyl]phenyl] 4-(N-naphthalen-2-ylanilino)benzoate (PubChem CID 139957847) has the molecular formula C90H65N3O6 and a molecular weight of 1284.53 g/mol. Its IUPAC name is [4-[1,1-bis[4-[4-(N-naphthalen-2-ylanilino)benzoyl]oxyphenyl]propyl]phenyl] 4-(N-naphthalen-2-ylanilino)benzoate.
| Compound Name | [4-[1,1-bis[4-[4-(N-naphthalen-2-ylanilino)benzoyl]oxyphenyl]propyl]phenyl] 4-(N-naphthalen-2-ylanilino)benzoate |
|---|---|
| PubChem CID | 139957847 |
| Molecular Formula | C90H65N3O6 |
| Molecular Weight | 1284.53 g/mol |
| Exact Mass | 1283.49 |
| IUPAC Name | [4-[1,1-bis[4-[4-(N-naphthalen-2-ylanilino)benzoyl]oxyphenyl]propyl]phenyl] 4-(N-naphthalen-2-ylanilino)benzoate |
| SMILES | CCC(c1ccc(OC(=O)c2ccc(N(c3ccccc3)c3ccc4ccccc4c3)cc2)cc1)(c1ccc(OC(=O)c2ccc(N(c3ccccc3)c3ccc4ccccc4c3)cc2)cc1)c1ccc(OC(=O)c2ccc(N(c3ccccc3)c3ccc4ccccc4c3)cc2)cc1 |
| InChI | InChI=1S/C90H65N3O6/c1-2-90(72-39-54-84(55-40-72)97-87(94)66-33-45-78(46-34-66)91(75-24-6-3-7-25-75)81-51-30-63-18-12-15-21-69(63)60-81,73-41-56-85(57-42-73)98-88(95)67-35-47-79(48-36-67)92(76-26-8-4-9-27-76)82-52-31-64-19-13-16-22-70(64)61-82)74-43-58-86(59-44-74)99-89(96)68-37-49-80(50-38-68)93(77-28-10-5-11-29-77)83-53-32-65-20-14-17-23-71(65)62-83/h3-62H,2H2,1H3 |
| InChIKey | VZZXLGAABAGZHC-UHFFFAOYSA-N |
| XLogP | 22.96 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 99 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1284.53 |
| LogP ≤ 5 | 22.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|