C42H45NO2 — CID 151556114
[2,6-diethyl-4-(2-ethyl-5-propan-2-ylphenyl)phenyl] 4-(4-methyl-N-(4-methylphenyl)anilino)benzoate (PubChem CID 151556114) has the molecular formula C42H45NO2 and a molecular weight of 595.83 g/mol. Its IUPAC name is [2,6-diethyl-4-(2-ethyl-5-propan-2-ylphenyl)phenyl] 4-(4-methyl-N-(4-methylphenyl)anilino)benzoate.
| Compound Name | [2,6-diethyl-4-(2-ethyl-5-propan-2-ylphenyl)phenyl] 4-(4-methyl-N-(4-methylphenyl)anilino)benzoate |
|---|---|
| PubChem CID | 151556114 |
| Molecular Formula | C42H45NO2 |
| Molecular Weight | 595.83 g/mol |
| Exact Mass | 595.35 |
| IUPAC Name | [2,6-diethyl-4-(2-ethyl-5-propan-2-ylphenyl)phenyl] 4-(4-methyl-N-(4-methylphenyl)anilino)benzoate |
| SMILES | CCc1ccc(C(C)C)cc1-c1cc(CC)c(OC(=O)c2ccc(N(c3ccc(C)cc3)c3ccc(C)cc3)cc2)c(CC)c1 |
| InChI | InChI=1S/C42H45NO2/c1-8-31-15-16-35(28(4)5)27-40(31)36-25-32(9-2)41(33(10-3)26-36)45-42(44)34-17-23-39(24-18-34)43(37-19-11-29(6)12-20-37)38-21-13-30(7)14-22-38/h11-28H,8-10H2,1-7H3 |
| InChIKey | QBMUKHLSDXTVRO-UHFFFAOYSA-N |
| XLogP | 11.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.83 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|