C44H41NO2 — CID 151874568
[4-(2-ethyl-5-propan-2-ylphenyl)phenyl] 4-[4-(3-methyl-N-(3-methylphenyl)anilino)phenyl]benzoate (PubChem CID 151874568) has the molecular formula C44H41NO2 and a molecular weight of 615.82 g/mol. Its IUPAC name is [4-(2-ethyl-5-propan-2-ylphenyl)phenyl] 4-[4-(3-methyl-N-(3-methylphenyl)anilino)phenyl]benzoate.
| Compound Name | [4-(2-ethyl-5-propan-2-ylphenyl)phenyl] 4-[4-(3-methyl-N-(3-methylphenyl)anilino)phenyl]benzoate |
|---|---|
| PubChem CID | 151874568 |
| Molecular Formula | C44H41NO2 |
| Molecular Weight | 615.82 g/mol |
| Exact Mass | 615.31 |
| IUPAC Name | [4-(2-ethyl-5-propan-2-ylphenyl)phenyl] 4-[4-(3-methyl-N-(3-methylphenyl)anilino)phenyl]benzoate |
| SMILES | CCc1ccc(C(C)C)cc1-c1ccc(OC(=O)c2ccc(-c3ccc(N(c4cccc(C)c4)c4cccc(C)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C44H41NO2/c1-6-33-13-18-38(30(2)3)29-43(33)36-21-25-42(26-22-36)47-44(46)37-16-14-34(15-17-37)35-19-23-39(24-20-35)45(40-11-7-9-31(4)27-40)41-12-8-10-32(5)28-41/h7-30H,6H2,1-5H3 |
| InChIKey | SNKBPDALZNLMFM-UHFFFAOYSA-N |
| XLogP | 12.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.82 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|