C20H23F3N6O3 — CID 150450021
5-carbamimidoyl-2-methyl-N-[[2-morpholin-4-yl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]pyridine-4-carboxamide (PubChem CID 150450021) has the molecular formula C20H23F3N6O3 and a molecular weight of 452.44 g/mol. Its IUPAC name is 5-carbamimidoyl-2-methyl-N-[[2-morpholin-4-yl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]pyridine-4-carboxamide.
| Compound Name | 5-carbamimidoyl-2-methyl-N-[[2-morpholin-4-yl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 150450021 |
| Molecular Formula | C20H23F3N6O3 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 5-carbamimidoyl-2-methyl-N-[[2-morpholin-4-yl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]pyridine-4-carboxamide |
| SMILES | [H]/N=C(\N)c1cnc(C)cc1C(=O)NCc1ccc(OCC(F)(F)F)nc1N1CCOCC1 |
| InChI | InChI=1S/C20H23F3N6O3/c1-12-8-14(15(10-26-12)17(24)25)19(30)27-9-13-2-3-16(32-11-20(21,22)23)28-18(13)29-4-6-31-7-5-29/h2-3,8,10H,4-7,9,11H2,1H3,(H3,24,25)(H,27,30) |
| InChIKey | HNOXJFSDLYUGDY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 126.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|