C12H15F3N4O — CID 79876857
2-(1,4-oxazepan-4-yl)-6-(trifluoromethyl)pyridine-3-carboximidamide (PubChem CID 79876857) has the molecular formula C12H15F3N4O and a molecular weight of 288.27 g/mol. Its IUPAC name is 2-(1,4-oxazepan-4-yl)-6-(trifluoromethyl)pyridine-3-carboximidamide.
| Compound Name | 2-(1,4-oxazepan-4-yl)-6-(trifluoromethyl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 79876857 |
| Molecular Formula | C12H15F3N4O |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 2-(1,4-oxazepan-4-yl)-6-(trifluoromethyl)pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(C(F)(F)F)nc1N1CCCOCC1 |
| InChI | InChI=1S/C12H15F3N4O/c13-12(14,15)9-3-2-8(10(16)17)11(18-9)19-4-1-6-20-7-5-19/h2-3H,1,4-7H2,(H3,16,17) |
| InChIKey | ACUQLBNMSXHLOD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 75.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|