C22H25NO3 — CID 15045076
(2S)-2-[3-(9H-fluoren-9-yl)propanoylamino]-3,3-dimethylbutanoic acid (PubChem CID 15045076) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is (2S)-2-[3-(9H-fluoren-9-yl)propanoylamino]-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-[3-(9H-fluoren-9-yl)propanoylamino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 15045076 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (2S)-2-[3-(9H-fluoren-9-yl)propanoylamino]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)[C@H](NC(=O)CCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C22H25NO3/c1-22(2,3)20(21(25)26)23-19(24)13-12-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h4-11,18,20H,12-13H2,1-3H3,(H,23,24)(H,25,26)/t20-/m1/s1 |
| InChIKey | SWBQGUWANGNDDA-HXUWFJFHSA-N |
| XLogP | 4.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |