C34H27N3O6 — CID 15045584
19-[(E)-3-(1,3-dioxoisoindol-2-yl)prop-1-enyl]-10-ethyl-10-hydroxy-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19-heptaene-5,9-dione (PubChem CID 15045584) has the molecular formula C34H27N3O6 and a molecular weight of 573.61 g/mol. Its IUPAC name is 19-[(E)-3-(1,3-dioxoisoindol-2-yl)prop-1-enyl]-10-ethyl-10-hydroxy-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19-heptaene-5,9-dione.
| Compound Name | 19-[(E)-3-(1,3-dioxoisoindol-2-yl)prop-1-enyl]-10-ethyl-10-hydroxy-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19-heptaene-5,9-dione |
|---|---|
| PubChem CID | 15045584 |
| Molecular Formula | C34H27N3O6 |
| Molecular Weight | 573.61 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | 19-[(E)-3-(1,3-dioxoisoindol-2-yl)prop-1-enyl]-10-ethyl-10-hydroxy-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19-heptaene-5,9-dione |
| SMILES | CCC1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccc(/C=C/CN3C(=O)c4ccccc4C3=O)c3c1c2CCC3 |
| InChI | InChI=1S/C34H27N3O6/c1-2-34(42)25-15-27-29-23(16-37(27)32(40)24(25)17-43-33(34)41)20-11-5-10-19-18(12-13-26(35-29)28(19)20)7-6-14-36-30(38)21-8-3-4-9-22(21)31(36)39/h3-4,6-9,12-13,15,42H,2,5,10-11,14,16-17H2,1H3/b7-6+ |
| InChIKey | LLEHWWYVPHLIFM-VOTSOKGWSA-N |
| XLogP | 3.88 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.61 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|