C31H23N3O7 — CID 15045596
19-[(1,3-dioxoisoindol-2-yl)methyl]-10-ethyl-10-hydroxy-8,21-dioxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19-heptaene-5,9-dione (PubChem CID 15045596) has the molecular formula C31H23N3O7 and a molecular weight of 549.54 g/mol. Its IUPAC name is 19-[(1,3-dioxoisoindol-2-yl)methyl]-10-ethyl-10-hydroxy-8,21-dioxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19-heptaene-5,9-dione.
| Compound Name | 19-[(1,3-dioxoisoindol-2-yl)methyl]-10-ethyl-10-hydroxy-8,21-dioxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19-heptaene-5,9-dione |
|---|---|
| PubChem CID | 15045596 |
| Molecular Formula | C31H23N3O7 |
| Molecular Weight | 549.54 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | 19-[(1,3-dioxoisoindol-2-yl)methyl]-10-ethyl-10-hydroxy-8,21-dioxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19-heptaene-5,9-dione |
| SMILES | CCC1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccc(CN3C(=O)c4ccccc4C3=O)c3c1c2CCO3 |
| InChI | InChI=1S/C31H23N3O7/c1-2-31(39)21-11-23-25-19(13-33(23)29(37)20(21)14-41-30(31)38)16-9-10-40-26-15(7-8-22(32-25)24(16)26)12-34-27(35)17-5-3-4-6-18(17)28(34)36/h3-8,11,39H,2,9-10,12-14H2,1H3 |
| InChIKey | NTYHKIIKLQMIHE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.54 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|