C17H13N5 — CID 150460233
N-(4-pyrazol-1-ylphenyl)quinazolin-2-amine (PubChem CID 150460233) has the molecular formula C17H13N5 and a molecular weight of 287.33 g/mol. Its IUPAC name is N-(4-pyrazol-1-ylphenyl)quinazolin-2-amine.
| Compound Name | N-(4-pyrazol-1-ylphenyl)quinazolin-2-amine |
|---|---|
| PubChem CID | 150460233 |
| Molecular Formula | C17H13N5 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | N-(4-pyrazol-1-ylphenyl)quinazolin-2-amine |
| SMILES | c1ccc2nc(Nc3ccc(-n4cccn4)cc3)ncc2c1 |
| InChI | InChI=1S/C17H13N5/c1-2-5-16-13(4-1)12-18-17(21-16)20-14-6-8-15(9-7-14)22-11-3-10-19-22/h1-12H,(H,18,20,21) |
| InChIKey | HPQAYKKBHBUSIC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |