C17H13BrClN3OS — CID 15046451
(2Z)-2-[(4-bromophenyl)hydrazinylidene]-1-(4-chlorophenyl)-2-(4,5-dihydro-1,3-thiazol-2-yl)ethanone (PubChem CID 15046451) has the molecular formula C17H13BrClN3OS and a molecular weight of 422.74 g/mol. Its IUPAC name is (2Z)-2-[(4-bromophenyl)hydrazinylidene]-1-(4-chlorophenyl)-2-(4,5-dihydro-1,3-thiazol-2-yl)ethanone.
| Compound Name | (2Z)-2-[(4-bromophenyl)hydrazinylidene]-1-(4-chlorophenyl)-2-(4,5-dihydro-1,3-thiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 15046451 |
| Molecular Formula | C17H13BrClN3OS |
| Molecular Weight | 422.74 g/mol |
| Exact Mass | 420.97 |
| IUPAC Name | (2Z)-2-[(4-bromophenyl)hydrazinylidene]-1-(4-chlorophenyl)-2-(4,5-dihydro-1,3-thiazol-2-yl)ethanone |
| SMILES | O=C(/C(=N/Nc1ccc(Br)cc1)C1=NCCS1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H13BrClN3OS/c18-12-3-7-14(8-4-12)21-22-15(17-20-9-10-24-17)16(23)11-1-5-13(19)6-2-11/h1-8,21H,9-10H2/b22-15- |
| InChIKey | JPRGWAGDNSUUFG-JCMHNJIXSA-N |
| XLogP | 4.90 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.74 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|