C20H33NO2 — CID 150468716
1-(2,6-dimethyl-4H-pyridin-1-yl)tridecane-1,2-dione (PubChem CID 150468716) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is 1-(2,6-dimethyl-4H-pyridin-1-yl)tridecane-1,2-dione.
| Compound Name | 1-(2,6-dimethyl-4H-pyridin-1-yl)tridecane-1,2-dione |
|---|---|
| PubChem CID | 150468716 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | 1-(2,6-dimethyl-4H-pyridin-1-yl)tridecane-1,2-dione |
| SMILES | CCCCCCCCCCCC(=O)C(=O)N1C(C)=CCC=C1C |
| InChI | InChI=1S/C20H33NO2/c1-4-5-6-7-8-9-10-11-12-16-19(22)20(23)21-17(2)14-13-15-18(21)3/h14-15H,4-13,16H2,1-3H3 |
| InChIKey | HRINOTJOBZVCOV-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|