C13H16N2O5S — CID 150469165
[(2-acetylpyrrolidine-1-carbonyl)amino] benzenesulfonate (PubChem CID 150469165) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is [(2-acetylpyrrolidine-1-carbonyl)amino] benzenesulfonate.
| Compound Name | [(2-acetylpyrrolidine-1-carbonyl)amino] benzenesulfonate |
|---|---|
| PubChem CID | 150469165 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | [(2-acetylpyrrolidine-1-carbonyl)amino] benzenesulfonate |
| SMILES | CC(=O)C1CCCN1C(=O)NOS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H16N2O5S/c1-10(16)12-8-5-9-15(12)13(17)14-20-21(18,19)11-6-3-2-4-7-11/h2-4,6-7,12H,5,8-9H2,1H3,(H,14,17) |
| InChIKey | HRKQTMLVLJGQFF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|