C17H19N5O — CID 150471195
3-[2-(cyclohexylamino)pyrimidin-4-yl]imidazo[1,2-a]pyridin-8-ol (PubChem CID 150471195) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-[2-(cyclohexylamino)pyrimidin-4-yl]imidazo[1,2-a]pyridin-8-ol.
| Compound Name | 3-[2-(cyclohexylamino)pyrimidin-4-yl]imidazo[1,2-a]pyridin-8-ol |
|---|---|
| PubChem CID | 150471195 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 3-[2-(cyclohexylamino)pyrimidin-4-yl]imidazo[1,2-a]pyridin-8-ol |
| SMILES | Oc1cccn2c(-c3ccnc(NC4CCCCC4)n3)cnc12 |
| InChI | InChI=1S/C17H19N5O/c23-15-7-4-10-22-14(11-19-16(15)22)13-8-9-18-17(21-13)20-12-5-2-1-3-6-12/h4,7-12,23H,1-3,5-6H2,(H,18,20,21) |
| InChIKey | HRVFARFDSJZGJJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |