About 3-cyclohexylimidazo[1,2-a]pyridin-8-ol
3-cyclohexylimidazo[1,2-a]pyridin-8-ol (PubChem CID 105470138) has the molecular formula C13H16N2O
and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-cyclohexylimidazo[1,2-a]pyridin-8-ol.
Molecular Properties
| Compound Name | 3-cyclohexylimidazo[1,2-a]pyridin-8-ol |
| PubChem CID | 105470138 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 3-cyclohexylimidazo[1,2-a]pyridin-8-ol |
| SMILES | Oc1cccn2c(C3CCCCC3)cnc12 |
| InChI | InChI=1S/C13H16N2O/c16-12-7-4-8-15-11(9-14-13(12)15)10-5-2-1-3-6-10/h4,7-10,16H,1-3,5-6H2 |
| InChIKey | WESWFAPDCCPOFT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclohexylimidazo[1,2-a]pyridin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexylimidazo[1,2-a]pyridin-8-ol?
The IUPAC name of 3-cyclohexylimidazo[1,2-a]pyridin-8-ol (CID 105470138) is 3-cyclohexylimidazo[1,2-a]pyridin-8-ol.
What is the SMILES notation for 3-cyclohexylimidazo[1,2-a]pyridin-8-ol?
The canonical SMILES for 3-cyclohexylimidazo[1,2-a]pyridin-8-ol is Oc1cccn2c(C3CCCCC3)cnc12.
What is the InChIKey of 3-cyclohexylimidazo[1,2-a]pyridin-8-ol?
The InChIKey is WESWFAPDCCPOFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O/c16-12-7-4-8-15-11(9-14-13(12)15)10-5-2-1-3-6-10/h4,7-10,16H,1-3,5-6H2.
What are the key properties of 3-cyclohexylimidazo[1,2-a]pyridin-8-ol?
3-cyclohexylimidazo[1,2-a]pyridin-8-ol has a molecular weight of 216.28 g/mol, XLogP of 3.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexylimidazo[1,2-a]pyridin-8-ol is sourced from PubChem (CID 105470138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).