C13H16N2O — CID 105470138
3-cyclohexylimidazo[1,2-a]pyridin-8-ol (PubChem CID 105470138) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-cyclohexylimidazo[1,2-a]pyridin-8-ol.
| Compound Name | 3-cyclohexylimidazo[1,2-a]pyridin-8-ol |
|---|---|
| PubChem CID | 105470138 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 3-cyclohexylimidazo[1,2-a]pyridin-8-ol |
| SMILES | Oc1cccn2c(C3CCCCC3)cnc12 |
| InChI | InChI=1S/C13H16N2O/c16-12-7-4-8-15-11(9-14-13(12)15)10-5-2-1-3-6-10/h4,7-10,16H,1-3,5-6H2 |
| InChIKey | WESWFAPDCCPOFT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |