C12H13ClN2 — CID 103095136
8-chloro-3-cyclopentylimidazo[1,2-a]pyridine (PubChem CID 103095136) has the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. Its IUPAC name is 8-chloro-3-cyclopentylimidazo[1,2-a]pyridine.
| Compound Name | 8-chloro-3-cyclopentylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 103095136 |
| Molecular Formula | C12H13ClN2 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 8-chloro-3-cyclopentylimidazo[1,2-a]pyridine |
| SMILES | Clc1cccn2c(C3CCCC3)cnc12 |
| InChI | InChI=1S/C12H13ClN2/c13-10-6-3-7-15-11(8-14-12(10)15)9-4-1-2-5-9/h3,6-9H,1-2,4-5H2 |
| InChIKey | KLEDLHYYILZGBZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |