C14H9ClN2O2 — CID 103095105
3-(1,3-benzodioxol-5-yl)-8-chloroimidazo[1,2-a]pyridine (PubChem CID 103095105) has the molecular formula C14H9ClN2O2 and a molecular weight of 272.69 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-8-chloroimidazo[1,2-a]pyridine.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-8-chloroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 103095105 |
| Molecular Formula | C14H9ClN2O2 |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-8-chloroimidazo[1,2-a]pyridine |
| SMILES | Clc1cccn2c(-c3ccc4c(c3)OCO4)cnc12 |
| InChI | InChI=1S/C14H9ClN2O2/c15-10-2-1-5-17-11(7-16-14(10)17)9-3-4-12-13(6-9)19-8-18-12/h1-7H,8H2 |
| InChIKey | JQMNAYMKQXGJEZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |