C18H12N4O2 — CID 146316041
3-(1,3-benzodioxol-5-yl)-6-pyridin-4-ylimidazo[1,2-a]pyrazine (PubChem CID 146316041) has the molecular formula C18H12N4O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-6-pyridin-4-ylimidazo[1,2-a]pyrazine.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-6-pyridin-4-ylimidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 146316041 |
| Molecular Formula | C18H12N4O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-6-pyridin-4-ylimidazo[1,2-a]pyrazine |
| SMILES | c1cc(-c2cn3c(-c4ccc5c(c4)OCO5)cnc3cn2)ccn1 |
| InChI | InChI=1S/C18H12N4O2/c1-2-16-17(24-11-23-16)7-13(1)15-8-21-18-9-20-14(10-22(15)18)12-3-5-19-6-4-12/h1-10H,11H2 |
| InChIKey | QOCKOIXUGDXSCR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 61.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |