About 3-(2,3-dihydro-1-benzofuran-5-yl)-6-(3-methoxyphenyl)imidazo[1,2-a]pyrazine
3-(2,3-dihydro-1-benzofuran-5-yl)-6-(3-methoxyphenyl)imidazo[1,2-a]pyrazine (PubChem CID 162668330) has the molecular formula C21H17N3O2
and a molecular weight of 343.39 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzofuran-5-yl)-6-(3-methoxyphenyl)imidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 3-(2,3-dihydro-1-benzofuran-5-yl)-6-(3-methoxyphenyl)imidazo[1,2-a]pyrazine |
| PubChem CID | 162668330 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 3-(2,3-dihydro-1-benzofuran-5-yl)-6-(3-methoxyphenyl)imidazo[1,2-a]pyrazine |
| SMILES | COc1cccc(-c2cn3c(-c4ccc5c(c4)CCO5)cnc3cn2)c1 |
| InChI | InChI=1S/C21H17N3O2/c1-25-17-4-2-3-14(10-17)18-13-24-19(11-23-21(24)12-22-18)15-5-6-20-16(9-15)7-8-26-20/h2-6,9-13H,7-8H2,1H3 |
| InChIKey | BWQGSVHKKQWFFX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2,3-dihydro-1-benzofuran-5-yl)-6-(3-methoxyphenyl)imidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydro-1-benzofuran-5-yl)-6-(3-methoxyphenyl)imidazo[1,2-a]pyrazine?
The IUPAC name of 3-(2,3-dihydro-1-benzofuran-5-yl)-6-(3-methoxyphenyl)imidazo[1,2-a]pyrazine (CID 162668330) is 3-(2,3-dihydro-1-benzofuran-5-yl)-6-(3-methoxyphenyl)imidazo[1,2-a]pyrazine.
What is the SMILES notation for 3-(2,3-dihydro-1-benzofuran-5-yl)-6-(3-methoxyphenyl)imidazo[1,2-a]pyrazine?
The canonical SMILES for 3-(2,3-dihydro-1-benzofuran-5-yl)-6-(3-methoxyphenyl)imidazo[1,2-a]pyrazine is COc1cccc(-c2cn3c(-c4ccc5c(c4)CCO5)cnc3cn2)c1.
What is the InChIKey of 3-(2,3-dihydro-1-benzofuran-5-yl)-6-(3-methoxyphenyl)imidazo[1,2-a]pyrazine?
The InChIKey is BWQGSVHKKQWFFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N3O2/c1-25-17-4-2-3-14(10-17)18-13-24-19(11-23-21(24)12-22-18)15-5-6-20-16(9-15)7-8-26-20/h2-6,9-13H,7-8H2,1H3.
What are the key properties of 3-(2,3-dihydro-1-benzofuran-5-yl)-6-(3-methoxyphenyl)imidazo[1,2-a]pyrazine?
3-(2,3-dihydro-1-benzofuran-5-yl)-6-(3-methoxyphenyl)imidazo[1,2-a]pyrazine has a molecular weight of 343.39 g/mol, XLogP of 4.01, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydro-1-benzofuran-5-yl)-6-(3-methoxyphenyl)imidazo[1,2-a]pyrazine is sourced from PubChem (CID 162668330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).