C14H14N2O2 — CID 117000684
7-(3-methoxyphenyl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine (PubChem CID 117000684) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 7-(3-methoxyphenyl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine.
| Compound Name | 7-(3-methoxyphenyl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine |
|---|---|
| PubChem CID | 117000684 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 7-(3-methoxyphenyl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine |
| SMILES | COc1cccc(-c2cnc3c(c2)OCCN3)c1 |
| InChI | InChI=1S/C14H14N2O2/c1-17-12-4-2-3-10(7-12)11-8-13-14(16-9-11)15-5-6-18-13/h2-4,7-9H,5-6H2,1H3,(H,15,16) |
| InChIKey | SHPWFJNONMZRQW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |