C8H7ClN4 — CID 83879193
8-chloroimidazo[1,2-a]pyridine-3-carboximidamide (PubChem CID 83879193) has the molecular formula C8H7ClN4 and a molecular weight of 194.63 g/mol. Its IUPAC name is 8-chloroimidazo[1,2-a]pyridine-3-carboximidamide.
| Compound Name | 8-chloroimidazo[1,2-a]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 83879193 |
| Molecular Formula | C8H7ClN4 |
| Molecular Weight | 194.63 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 8-chloroimidazo[1,2-a]pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1cnc2c(Cl)cccn12 |
| InChI | InChI=1S/C8H7ClN4/c9-5-2-1-3-13-6(7(10)11)4-12-8(5)13/h1-4H,(H3,10,11) |
| InChIKey | WZKLZUQPHAMICC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.63 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|