C9H9FN4 — CID 83877973
2-(8-fluoroimidazo[1,2-a]pyridin-3-yl)ethanimidamide (PubChem CID 83877973) has the molecular formula C9H9FN4 and a molecular weight of 192.20 g/mol. Its IUPAC name is 2-(8-fluoroimidazo[1,2-a]pyridin-3-yl)ethanimidamide.
| Compound Name | 2-(8-fluoroimidazo[1,2-a]pyridin-3-yl)ethanimidamide |
|---|---|
| PubChem CID | 83877973 |
| Molecular Formula | C9H9FN4 |
| Molecular Weight | 192.20 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 2-(8-fluoroimidazo[1,2-a]pyridin-3-yl)ethanimidamide |
| SMILES | [H]/N=C(\N)Cc1cnc2c(F)cccn12 |
| InChI | InChI=1S/C9H9FN4/c10-7-2-1-3-14-6(4-8(11)12)5-13-9(7)14/h1-3,5H,4H2,(H3,11,12) |
| InChIKey | PASPKOQAXDRYEH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.20 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|