C7H4ClFN2O2S — CID 84698128
8-fluoroimidazo[1,2-a]pyridine-3-sulfonyl chloride (PubChem CID 84698128) has the molecular formula C7H4ClFN2O2S and a molecular weight of 234.64 g/mol. Its IUPAC name is 8-fluoroimidazo[1,2-a]pyridine-3-sulfonyl chloride.
| Compound Name | 8-fluoroimidazo[1,2-a]pyridine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 84698128 |
| Molecular Formula | C7H4ClFN2O2S |
| Molecular Weight | 234.64 g/mol |
| Exact Mass | 233.97 |
| IUPAC Name | 8-fluoroimidazo[1,2-a]pyridine-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cnc2c(F)cccn12 |
| InChI | InChI=1S/C7H4ClFN2O2S/c8-14(12,13)6-4-10-7-5(9)2-1-3-11(6)7/h1-4H |
| InChIKey | HASRXKWNBDFGII-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.64 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |