About (8-fluoroimidazo[1,2-a]pyridin-2-yl)methanesulfonyl chloride
(8-fluoroimidazo[1,2-a]pyridin-2-yl)methanesulfonyl chloride (PubChem CID 84706684) has the molecular formula C8H6ClFN2O2S
and a molecular weight of 248.67 g/mol. Its IUPAC name is (8-fluoroimidazo[1,2-a]pyridin-2-yl)methanesulfonyl chloride.
Analyze (8-fluoroimidazo[1,2-a]pyridin-2-yl)methanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-fluoroimidazo[1,2-a]pyridin-2-yl)methanesulfonyl chloride?
The IUPAC name of (8-fluoroimidazo[1,2-a]pyridin-2-yl)methanesulfonyl chloride (CID 84706684) is (8-fluoroimidazo[1,2-a]pyridin-2-yl)methanesulfonyl chloride.
What is the SMILES notation for (8-fluoroimidazo[1,2-a]pyridin-2-yl)methanesulfonyl chloride?
The canonical SMILES for (8-fluoroimidazo[1,2-a]pyridin-2-yl)methanesulfonyl chloride is O=S(=O)(Cl)Cc1cn2cccc(F)c2n1.
What is the InChIKey of (8-fluoroimidazo[1,2-a]pyridin-2-yl)methanesulfonyl chloride?
The InChIKey is WISUTYQUTVWGIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClFN2O2S/c9-15(13,14)5-6-4-12-3-1-2-7(10)8(12)11-6/h1-4H,5H2.
What are the key properties of (8-fluoroimidazo[1,2-a]pyridin-2-yl)methanesulfonyl chloride?
(8-fluoroimidazo[1,2-a]pyridin-2-yl)methanesulfonyl chloride has a molecular weight of 248.67 g/mol, XLogP of 1.54, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (8-fluoroimidazo[1,2-a]pyridin-2-yl)methanesulfonyl chloride is sourced from PubChem (CID 84706684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).