C7H6ClN5O — CID 141408708
8-chloro-[1,2,4]triazolo[4,3-a]pyridine-3-carbohydrazide (PubChem CID 141408708) has the molecular formula C7H6ClN5O and a molecular weight of 211.61 g/mol. Its IUPAC name is 8-chloro-[1,2,4]triazolo[4,3-a]pyridine-3-carbohydrazide.
| Compound Name | 8-chloro-[1,2,4]triazolo[4,3-a]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 141408708 |
| Molecular Formula | C7H6ClN5O |
| Molecular Weight | 211.61 g/mol |
| Exact Mass | 211.03 |
| IUPAC Name | 8-chloro-[1,2,4]triazolo[4,3-a]pyridine-3-carbohydrazide |
| SMILES | NNC(=O)c1nnc2c(Cl)cccn12 |
| InChI | InChI=1S/C7H6ClN5O/c8-4-2-1-3-13-5(4)11-12-6(13)7(14)10-9/h1-3H,9H2,(H,10,14) |
| InChIKey | RRVOLWBTZZMJGD-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.61 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|