C18H24ClN5OS — CID 177049442
6-benzylsulfanyl-8-chloro-[1,2,4]triazolo[4,3-a]pyridine-3-carbohydrazide;ethane (PubChem CID 177049442) has the molecular formula C18H24ClN5OS and a molecular weight of 393.94 g/mol. Its IUPAC name is 6-benzylsulfanyl-8-chloro-[1,2,4]triazolo[4,3-a]pyridine-3-carbohydrazide;ethane.
| Compound Name | 6-benzylsulfanyl-8-chloro-[1,2,4]triazolo[4,3-a]pyridine-3-carbohydrazide;ethane |
|---|---|
| PubChem CID | 177049442 |
| Molecular Formula | C18H24ClN5OS |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 6-benzylsulfanyl-8-chloro-[1,2,4]triazolo[4,3-a]pyridine-3-carbohydrazide;ethane |
| SMILES | CC.CC.NNC(=O)c1nnc2c(Cl)cc(SCc3ccccc3)cn12 |
| InChI | InChI=1S/C14H12ClN5OS.2C2H6/c15-11-6-10(22-8-9-4-2-1-3-5-9)7-20-12(11)18-19-13(20)14(21)17-16;2*1-2/h1-7H,8,16H2,(H,17,21);2*1-2H3 |
| InChIKey | OLSADWOCRHHJGO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|