C7H6ClN5 — CID 83879652
6-chloroimidazo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 83879652) has the molecular formula C7H6ClN5 and a molecular weight of 195.61 g/mol. Its IUPAC name is 6-chloroimidazo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | 6-chloroimidazo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 83879652 |
| Molecular Formula | C7H6ClN5 |
| Molecular Weight | 195.61 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | 6-chloroimidazo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1cnc2ccc(Cl)nn12 |
| InChI | InChI=1S/C7H6ClN5/c8-5-1-2-6-11-3-4(7(9)10)13(6)12-5/h1-3H,(H3,9,10) |
| InChIKey | BMCVAOIVMQLWKR-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.61 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|