C54H54 — CID 15047165
1,2,3,4,5,6-hexakis(5,5-dimethylhexa-1,3-diynyl)benzene (PubChem CID 15047165) has the molecular formula C54H54 and a molecular weight of 703.03 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexakis(5,5-dimethylhexa-1,3-diynyl)benzene.
| Compound Name | 1,2,3,4,5,6-hexakis(5,5-dimethylhexa-1,3-diynyl)benzene |
|---|---|
| PubChem CID | 15047165 |
| Molecular Formula | C54H54 |
| Molecular Weight | 703.03 g/mol |
| Exact Mass | 702.42 |
| IUPAC Name | 1,2,3,4,5,6-hexakis(5,5-dimethylhexa-1,3-diynyl)benzene |
| SMILES | CC(C)(C)C#CC#Cc1c(C#CC#CC(C)(C)C)c(C#CC#CC(C)(C)C)c(C#CC#CC(C)(C)C)c(C#CC#CC(C)(C)C)c1C#CC#CC(C)(C)C |
| InChI | InChI=1S/C54H54/c1-49(2,3)37-25-19-31-43-44(32-20-26-38-50(4,5)6)46(34-22-28-40-52(10,11)12)48(36-24-30-42-54(16,17)18)47(35-23-29-41-53(13,14)15)45(43)33-21-27-39-51(7,8)9/h1-18H3 |
| InChIKey | FJGOANBYPBEMCZ-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.03 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|