C26H54O2 — CID 150477010
2-methyl-4,4-bis[(2-methylpropan-2-yl)oxy]-5-(2-methylpropyl)tridecane (PubChem CID 150477010) has the molecular formula C26H54O2 and a molecular weight of 398.72 g/mol. Its IUPAC name is 2-methyl-4,4-bis[(2-methylpropan-2-yl)oxy]-5-(2-methylpropyl)tridecane.
| Compound Name | 2-methyl-4,4-bis[(2-methylpropan-2-yl)oxy]-5-(2-methylpropyl)tridecane |
|---|---|
| PubChem CID | 150477010 |
| Molecular Formula | C26H54O2 |
| Molecular Weight | 398.72 g/mol |
| Exact Mass | 398.41 |
| IUPAC Name | 2-methyl-4,4-bis[(2-methylpropan-2-yl)oxy]-5-(2-methylpropyl)tridecane |
| SMILES | CCCCCCCCC(CC(C)C)C(CC(C)C)(OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C26H54O2/c1-12-13-14-15-16-17-18-23(19-21(2)3)26(20-22(4)5,27-24(6,7)8)28-25(9,10)11/h21-23H,12-20H2,1-11H3 |
| InChIKey | HSZYQOLHQSSJJS-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.72 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|