C20H22FN3O2 — CID 150489878
2-amino-6-fluoro-N-(3-hept-2-ynoxyphenyl)-5-methylpyridine-3-carboxamide (PubChem CID 150489878) has the molecular formula C20H22FN3O2 and a molecular weight of 355.41 g/mol. Its IUPAC name is 2-amino-6-fluoro-N-(3-hept-2-ynoxyphenyl)-5-methylpyridine-3-carboxamide.
| Compound Name | 2-amino-6-fluoro-N-(3-hept-2-ynoxyphenyl)-5-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 150489878 |
| Molecular Formula | C20H22FN3O2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 2-amino-6-fluoro-N-(3-hept-2-ynoxyphenyl)-5-methylpyridine-3-carboxamide |
| SMILES | CCCCC#CCOc1cccc(NC(=O)c2cc(C)c(F)nc2N)c1 |
| InChI | InChI=1S/C20H22FN3O2/c1-3-4-5-6-7-11-26-16-10-8-9-15(13-16)23-20(25)17-12-14(2)18(21)24-19(17)22/h8-10,12-13H,3-5,11H2,1-2H3,(H2,22,24)(H,23,25) |
| InChIKey | HVOOCJVCNDIXCJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|